Haloxyfop-P-methyl structure
|
Common Name | Haloxyfop-P-methyl | ||
|---|---|---|---|---|
| CAS Number | 72619-32-0 | Molecular Weight | 375.72700 | |
| Density | 0.968 | Boiling Point | 390.818ºC at 760 mmHg | |
| Molecular Formula | C16H13ClF3NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 2ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of Haloxyfop-P-methylHaloxyfop-P-methyl is an aryloxyphenoxypropionate herbicide. Haloxyfop-P-methyl can be absorbed by roots or foliage and hampers lipogenesis and increases oxidative stress in target plants[1]. |
| Name | haloxyfop-P-methyl |
|---|---|
| Synonym | More Synonyms |
| Description | Haloxyfop-P-methyl is an aryloxyphenoxypropionate herbicide. Haloxyfop-P-methyl can be absorbed by roots or foliage and hampers lipogenesis and increases oxidative stress in target plants[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.968 |
|---|---|
| Boiling Point | 390.818ºC at 760 mmHg |
| Molecular Formula | C16H13ClF3NO4 |
| Molecular Weight | 375.72700 |
| Flash Point | 2ºC |
| Exact Mass | 375.04900 |
| PSA | 57.65000 |
| LogP | 4.48640 |
| Index of Refraction | 1.513 |
| InChIKey | MFSWTRQUCLNFOM-SECBINFHSA-N |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | 8.74 mg/L at 20 ºC |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302-H312-H319-H332 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R50/53 |
| Safety Phrases | S2-S60-S61 |
| RIDADR | UN1648 3 |
| HS Code | 2933399025 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399025 |
|---|---|
| Summary | 2933399025. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:20.0% |
| Haloxyfop-P-methyl |
| EINECS 406-250-0 |
| methyl (2R)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| haloxyfop-R-methyl |
| methyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| 2-(4-((3-Chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)-propanoic acid methyl ester |
| methyl (R)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate |
| MFCD04112762 |