2-(4-dimethylaminophenyl)thiazolidine-4-carboxylic acid structure
|
Common Name | 2-(4-dimethylaminophenyl)thiazolidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 72678-86-5 | Molecular Weight | 252.33300 | |
| Density | 1.27g/cm3 | Boiling Point | 481.4ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245ºC | |
| Name | 2-[4-(dimethylamino)phenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 481.4ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.33300 |
| Flash Point | 245ºC |
| Exact Mass | 252.09300 |
| PSA | 77.87000 |
| LogP | 1.86960 |
| Index of Refraction | 1.624 |
| InChIKey | UVBBPRJLXWJSHK-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2NC(C(=O)O)CS2)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
2-(4-dimethylam... CAS#:72678-86-5 |
| Literature: Luhowy,R.; Meneghini,F. Journal of the American Chemical Society, 1979 , vol. 101, p. 420 - 426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<4-Chlor-phenyl>-thiazolidin-4-carbonsaeure |
| 2-(4'-Chlorphenyl)-4-thiazolidincarbonsaeure |
| 2-(4-chloro-phenyl)-thiazolidine-4-carboxylic acid |
| N,S-(4-chloro-benzylidene)-cysteine |
| (R)-2-(4-Chloro-phenyl)-thiazolidine-4-carboxylic |
| N,S-(4-dimethylamino-benzylidene)-cysteine |
| 2-(p-Dimethylamino-phenyl)-thiazolidin-4-carbonsaeure |
| 2-(4-dimethylamino-phenyl)-thiazolidine-4-carboxylic acid |
| 2-(4-chlorophenyl)-1,3-thiazolane-4-carboxylic acid |