HP210
Modify Date: 2025-09-16 14:56:48
HP210 structure
|
Common Name | HP210 | ||
|---|---|---|---|---|
| CAS Number | 728039-52-9 | Molecular Weight | 421.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HP210HP210 is a selective glucocorticoid receptor modulator (SGRM). HP210 can inhibit the mRNA expression of IL-1β and IL-6. HP210 has the potential to study inflammation-related diseases[1]. |
| Name | HP210 |
|---|
| Description | HP210 is a selective glucocorticoid receptor modulator (SGRM). HP210 can inhibit the mRNA expression of IL-1β and IL-6. HP210 has the potential to study inflammation-related diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H19N3O2S2 |
|---|---|
| Molecular Weight | 421.54 |
| InChIKey | AJJBGZJAGZSMJI-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)c1ccc(Cn2c(=S)[nH]c3ccsc3c2=O)cc1)c1ccccc1 |