deoxyartemisinin structure
|
Common Name | deoxyartemisinin | ||
|---|---|---|---|---|
| CAS Number | 72826-63-2 | Molecular Weight | 266.333 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 387.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | 104-106ºC | |
| MSDS | N/A | Flash Point | 171.5±26.5 °C | |
Use of deoxyartemisininDeoxy artemisinin, a orally bioavailable compound separated from Artemisinin annua L., shows anti-inflammatory and antiulcer activities[1]. |
| Name | 2-deoxyartemisinin |
|---|---|
| Synonym | More Synonyms |
| Description | Deoxy artemisinin, a orally bioavailable compound separated from Artemisinin annua L., shows anti-inflammatory and antiulcer activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.9±37.0 °C at 760 mmHg |
| Melting Point | 104-106ºC |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.333 |
| Flash Point | 171.5±26.5 °C |
| Exact Mass | 266.151794 |
| PSA | 44.76000 |
| LogP | 2.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | ZQGMLVQZBIKKMP-NNWCWBAJSA-N |
| SMILES | CC1CCC2C(C)C(=O)OC3OC4(C)CCC1C32O4 |
| Storage condition | -20°C Freezer |
| Hazard Codes | Xi |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| Qing Hau Sau III |
| desoxyartemisinin |
| Deoxyarteannuin |
| Qinghaosu III |
| deoxyartemisinin |
| (3R,3aS,6R,6aS,10aS,10bR)-3,6,9-trimethyloctahydro-9,10b-epoxyoxepino[4,3,2-ij]isochromen-2(3H,10aH)-one |
| desoxoartemisinin |
| (1S,4S,5R,8S,9R,12S,13R)-1,5,9-Trimethyl-11,14,15-trioxatetracyclo[10.2.1.0.0]pentadecan-10-one |
| Hydroarteannuin |
| Deoxyqinghaosu |