O-Methylcedrelopsin structure
|
Common Name | O-Methylcedrelopsin | ||
|---|---|---|---|---|
| CAS Number | 72916-61-1 | Molecular Weight | 274.31200 | |
| Density | N/A | Boiling Point | 429.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O4 | Melting Point | 68 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of O-MethylcedrelopsinO-Methylcedrelopsin is a coumarin that can be isolated from the stems of Ticorea longiflora[1]. |
| Name | 6,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | O-Methylcedrelopsin is a coumarin that can be isolated from the stems of Ticorea longiflora[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 429.9±45.0 °C at 760 mmHg |
|---|---|
| Melting Point | 68 °C |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31200 |
| Exact Mass | 274.12100 |
| PSA | 48.67000 |
| LogP | 3.31890 |
| InChIKey | NNBURDJZOIAAHY-UHFFFAOYSA-N |
| SMILES | COc1cc2ccc(=O)oc2c(CC=C(C)C)c1OC |
| HMS2269J07 |
| 2H-1-Benzopyran-2-one,6,7-dimethoxy-8-(3-methyl-2-butenyl) |
| O-Methylcedrelopsin |