Phosmet structure
|
Common Name | Phosmet | ||
|---|---|---|---|---|
| CAS Number | 732-11-6 | Molecular Weight | 317.321 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 412.6±47.0 °C at 760 mmHg | |
| Molecular Formula | C11H12NO4PS2 | Melting Point | 72.5°C | |
| MSDS | Chinese USA | Flash Point | 203.3±29.3 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | phosmet |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.6±47.0 °C at 760 mmHg |
| Melting Point | 72.5°C |
| Molecular Formula | C11H12NO4PS2 |
| Molecular Weight | 317.321 |
| Flash Point | 203.3±29.3 °C |
| Exact Mass | 316.994537 |
| PSA | 123.04000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | LMNZTLDVJIUSHT-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SCN1C(=O)c2ccccc2C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H330-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P260-P280-P304 + P340 + P310-P403 + P233 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R21/22;R50/53 |
| Safety Phrases | S22-S36/37-S60-S61 |
| RIDADR | UN 2811 |
| RTECS | TE2275000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~%
Phosmet CAS#:732-11-6 |
| Literature: DE930446 , ; |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
|
Effects of postharvest preparation on organophosphate insecticide residues in apples.
J. Agric. Food Chem. 56(3) , 916-21, (2008) Apples were sampled directly from orchard trees at 96, 45, and 21 days postapplication with one of three organophosphate insecticides (azinphos methyl, phosalone, or phosmet, respectively). Individual... |
|
|
Structure and interactions in fluids of prolate colloidal ellipsoids: comparison between experiment, theory, and simulation.
J. Chem. Phys. 137(18) , 184505, (2012) The microscopic structure of fluids of simple spheres is well known. However, the constituents of most real-life fluids are non-spherical, leading to a coupling between the rotational and translationa... |
|
|
Evaluation of chemical and photochemical oxidation processes for degradation of phosmet on lowbush blueberries (Vaccinium angustifolium).
J. Agric. Food Chem. 54(25) , 9608-13, (2006) Chemical and photochemical oxidation processes were evaluated for their ability to degrade residual phosmet on lowbush blueberries and for their role in the conversion of phosmet to phosmet oxon--a to... |
| IMIDN |
| S-[(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-dimethyl phosphorodithioate |
| Safidon |
| MFCD00055501 |
| O,O-dimethyl S-phthalimidomethyl phosphorodithioate |
| Phosphorodithioic Acid S-[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-Dimethyl Ester |
| Smidan |
| Dithiophosphate de S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)méthyle] et de O,O-diméthyle |
| simidan |
| Phosphorodithioic acid, S-((1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl) O,O-dimethyl ester |
| Phosmet |
| Phosphorodithioic acid, S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-dimethyl ester |
| EINECS 211-987-4 |
| S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] phosphorodithioic acid O,O-dimethyl ester |
| S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] O,O-dimethyl phosphorodithioate |
| N-(mercaptomethyl)phthalimide S-(O,O-dimethyl phosphorodithioate) |
| Phosphorodithioic Acid O,O-Dimethyl Ester S-Ester with N-(Mercaptomethyl)phthalimide |
| phthalophos |
| S-[(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]-O,O-dimethyldithiophosphat |
| PMP |
| imidan |
| N-(dimethoxyphosphinothioylthiomethyl)phthalimide |
| FOSDAN |
| Fosmet |
| Prolate |
| R-1504 |
| INOVAT |