3-amino-2,3-dimorpholin-4-yl-prop-2-enenitrile structure
|
Common Name | 3-amino-2,3-dimorpholin-4-yl-prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 73304-65-1 | Molecular Weight | 238.28600 | |
| Density | 1.25g/cm3 | Boiling Point | 428ºC at 760 mmHg | |
| Molecular Formula | C11H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | (E)-3-amino-2,3-dimorpholin-4-ylprop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 428ºC at 760 mmHg |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.28600 |
| Flash Point | 212.6ºC |
| Exact Mass | 238.14300 |
| PSA | 74.75000 |
| Index of Refraction | 1.565 |
| InChIKey | PDMROBRLHMYGMH-ZHACJKMWSA-N |
| SMILES | N#CC(=C(N)N1CCOCC1)N1CCOCC1 |
|
~%
3-amino-2,3-dim... CAS#:73304-65-1 |
| Literature: Stansfield,F.; Coomassie,M.D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 2708 - 2710 |
|
~%
3-amino-2,3-dim... CAS#:73304-65-1 |
| Literature: Stansfield,F.; Coomassie,M.D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 2708 - 2710 |
|
~%
3-amino-2,3-dim... CAS#:73304-65-1 |
| Literature: Stansfield,F.; Coomassie,M.D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 2708 - 2710 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-amino-2,3-di-morpholin-4-yl-acrylonitrile |
| 3-Amino-2,3-bis-(4-morpholino)-acrylonitril |