(3-nitronaphthalen-2-yl)methanol structure
|
Common Name | (3-nitronaphthalen-2-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 73428-04-3 | Molecular Weight | 203.19400 | |
| Density | 1.361g/cm3 | Boiling Point | 397.8ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 118-119ºC | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | (3-nitronaphthalen-2-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760 mmHg |
| Melting Point | 118-119ºC |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 175.9ºC |
| Exact Mass | 203.05800 |
| PSA | 66.05000 |
| LogP | 2.76350 |
| Index of Refraction | 1.69 |
| InChIKey | YLIFSPRRWWMMPC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2ccccc2cc1CO |
|
~95%
(3-nitronaphtha... CAS#:73428-04-3 |
| Literature: Wani; Ronman; Lindley; Wall Journal of Medicinal Chemistry, 1980 , vol. 23, # 5 p. 554 - 560 |
|
~%
(3-nitronaphtha... CAS#:73428-04-3 |
| Literature: Organic Letters, , vol. 6, # 19 p. 3353 - 3356 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-nitro-2-napthalenemethanol |
| 2-Nitro-3-naphthalenemethanol |
| 3-Nitro-2-naphthalinmethanol |
| 3-Nitro-2-naphthalenemethanol |
| 2-Naphthalenemethanol,3-nitro |
| 3-NITRONAPHTHALENE-2-METHANOL |