2'-fluoro-2-methylamino-5-nitrobenzophenone structure
|
Common Name | 2'-fluoro-2-methylamino-5-nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 735-06-8 | Molecular Weight | 274.247 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 478.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H11FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4±28.7 °C | |
| Name | (2-Fluorophenyl)(2-(methylamino)-5-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.8±45.0 °C at 760 mmHg |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.247 |
| Flash Point | 243.4±28.7 °C |
| Exact Mass | 274.075378 |
| PSA | 74.92000 |
| LogP | 3.85 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | GVXPKRIRHDRCGY-UHFFFAOYSA-N |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
|
~%
2'-fluoro-2-met... CAS#:735-06-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 6, p. 261 - 265 |
|
~%
2'-fluoro-2-met... CAS#:735-06-8 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 80, # 5 p. 459 - 468 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2-fluorophenyl)-[2-(methylamino)-5-nitrophenyl]methanone |
| Methanone, (2-fluorophenyl)[2-(methylamino)-5-nitrophenyl]- |
| EINECS 211-998-4 |
| MFCD06658167 |
| (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone |