Benzenesulfonamide,N-(4-methyl-2-nitrophenyl)- structure
|
Common Name | Benzenesulfonamide,N-(4-methyl-2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 735-57-9 | Molecular Weight | 292.31000 | |
| Density | 1.414g/cm3 | Boiling Point | 465.6ºC at 760mmHg | |
| Molecular Formula | C13H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | n 177 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 465.6ºC at 760mmHg |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.31000 |
| Flash Point | 235.4ºC |
| Exact Mass | 292.05200 |
| PSA | 100.37000 |
| LogP | 4.38100 |
| Index of Refraction | 1.641 |
| InChIKey | MJUHDEYUFJKWTI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 |
|
~%
Benzenesulfonam... CAS#:735-57-9 |
| Literature: Lellmann Chemische Berichte, 1883 , vol. 16, p. 595 Justus Liebigs Annalen der Chemie, 1883 , vol. 221, p. 18 |
|
~%
Benzenesulfonam... CAS#:735-57-9 |
| Literature: Leuckart Journal fuer Praktische Chemie (Leipzig), 1890 , vol. <2>41, p. 327 |
|
~%
Benzenesulfonam... CAS#:735-57-9 |
| Literature: Degani,J. et al. Gazzetta Chimica Italiana, 1962 , vol. 92, p. 1204 - 1212 |
|
~%
Benzenesulfonam... CAS#:735-57-9 |
| Literature: Platt Journal of the Chemical Society, 1948 , p. 1310,1312 |
| Aniline,N,N-dimethyl-p-phenylsulfonamido |
| (4-methyl-2-nitrophenyl)(phenylsulfonyl)amine |
| N-Benzolsulfonyl-2-nitro-4-methyl-anilin |
| 3-Nitro-4-benzolsulfamino-toluol |
| Benzolsulfonsaeure-(4-dimethylamino-anilid) |
| benzenesulfonic acid-(4-methyl-2-nitro-anilide) |
| Benzolsulfonsaeure-(2-nitro-4-methyl-anilid) |
| benzenesulfonic acid-(4-dimethylamino-anilide) |
| Benzolsulfonsaeure-(4-methyl-2-nitro-anilid) |
| N-(4-dimethylaminophenyl)benzenesulfonamide |