Benzenesulfono-p-toluidide structure
|
Common Name | Benzenesulfono-p-toluidide | ||
|---|---|---|---|---|
| CAS Number | 6311-65-5 | Molecular Weight | 247.31300 | |
| Density | 1.269g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.31300 |
| Flash Point | 191.9ºC |
| Exact Mass | 247.06700 |
| PSA | 54.55000 |
| LogP | 3.94960 |
| Index of Refraction | 1.621 |
| InChIKey | UOPLDEWGEPWRMH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
|
Name: Cytotoxicity against human LNCaP cells after 5 days by MTT assay
Source: ChEMBL
Target: LNCaP
External Id: CHEMBL978652
|
|
Name: Down regulation of androgen receptor expression in human LNCaP cells by Western blot ...
Source: ChEMBL
Target: LNCaP
External Id: CHEMBL978654
|
|
Name: Cytotoxicity against human PC3 cells after 5 days by MTT assay
Source: ChEMBL
Target: PC-3
External Id: CHEMBL978653
|
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Protonation constant (Proton-ligand formation constant) was determined
Source: ChEMBL
Target: N/A
External Id: CHEMBL839087
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
| Benzenesulfono-p-toluidide |
| benzenesulfonyl p-methylaniline |
| N-(p-tolyl)benzenesulfonamide |
| N-p-Tolyl-benzolsulfonamid |
| (4-methylphenyl)(phenylsulfonyl)amine |
| benzenesulfonic acid p-toluidide |