AKOS BBS-00000268
Modify Date: 2025-09-13 12:06:54
AKOS BBS-00000268 structure
|
Common Name | AKOS BBS-00000268 | ||
|---|---|---|---|---|
| CAS Number | 73863-51-1 | Molecular Weight | 256.12800 | |
| Density | 1.3g/cm3 | Boiling Point | 384.7ºC at 760 mmHg | |
| Molecular Formula | C12H11Cl2NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186.5ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2-chloro-3-(2-chloroethyl)-7-methoxyquinoline |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 384.7ºC at 760 mmHg |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.12800 |
| Flash Point | 186.5ºC |
| Exact Mass | 255.02200 |
| PSA | 22.12000 |
| LogP | 3.67810 |
| Index of Refraction | 1.608 |
| InChIKey | PTQQTMBBFHOZTL-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(CCCl)c(Cl)nc2c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
|
~76%
AKOS BBS-00000268 CAS#:73863-51-1 |
| Literature: Meth-Cohn, Otto; Rhouati, Salah; Tarnowski, Brian; Robinson, Andrew Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1537 - 1543 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |