6-Methoxy-3-nitropyridin-2-amin structure
|
Common Name | 6-Methoxy-3-nitropyridin-2-amin | ||
|---|---|---|---|---|
| CAS Number | 73896-36-3 | Molecular Weight | 169.138 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 338.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H7N3O3 | Melting Point | 171-172°C | |
| MSDS | Chinese USA | Flash Point | 158.5±26.5 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 2-Amino-6-methoxy-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.5±37.0 °C at 760 mmHg |
| Melting Point | 171-172°C |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.138 |
| Flash Point | 158.5±26.5 °C |
| Exact Mass | 169.048737 |
| PSA | 93.96000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | RDJILYVRVOTMTQ-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(N)n1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H319-H334-H335 |
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xi |
| Risk Phrases | 22-36/37/38-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03206481 |
| 2-Pyridinamine, 6-methoxy-3-nitro- |
| 6-Méthoxy-3-nitro-2-pyridinamine |
| 6-Methoxy-3-nitropyridin-2-amin |
| 2-Amino-3-nitro-6-methoxypyridine |
| 6-methoxy-3-nitropyridin-2-amine |