2,4-Diamino-6-(hydroxymethyl)pteridine hydrochloride structure
|
Common Name | 2,4-Diamino-6-(hydroxymethyl)pteridine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 73978-41-3 | Molecular Weight | 228.639 | |
| Density | N/A | Boiling Point | 636.5ºC at 760 mmHg | |
| Molecular Formula | C7H9ClN6O | Melting Point | 220ºC(lit.) | |
| MSDS | N/A | Flash Point | 338.8ºC | |
| Name | (2,4-Diaminopteridin-6-yl)methanol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 636.5ºC at 760 mmHg |
|---|---|
| Melting Point | 220ºC(lit.) |
| Molecular Formula | C7H9ClN6O |
| Molecular Weight | 228.639 |
| Flash Point | 338.8ºC |
| Exact Mass | 228.052643 |
| PSA | 123.83000 |
| LogP | 1.04090 |
| InChIKey | XZHMPUJCSYVIQL-UHFFFAOYSA-N |
| SMILES | Cl.Nc1nc(N)c2nc(CO)cnc2n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3.0 |
| HS Code | 2933990090 |
|
~67%
2,4-Diamino-6-(... CAS#:73978-41-3 |
| Literature: Boyle, Peter H.; Pfleiderer, Wolfgang Chemische Berichte, 1980 , vol. 113, # 4 p. 1514 - 1523 |
|
~%
2,4-Diamino-6-(... CAS#:73978-41-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 28, # 5 p. 660 - 667 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| T66 BN DN GN JNJ CZ EZ H1Q &&HCl |
| 6-Pteridinemethanol, 2,4-diamino-, hydrochloride (1:1) |
| (2,4-Diamino-6-pteridinyl)methanol hydrochloride (1:1) |
| (2,4-diaminopteridin-6-yl)methanol hydrochloride hydrate |
| 2,4-Diamino-6-(hydroxymethyl)pteridine hydrochloride |
| MFCD00191246 |
| (2,4-Diaminopteridin-6-yl)methanol hydrochloride (1:1) |