Magneson structure
|
Common Name | Magneson | ||
|---|---|---|---|---|
| CAS Number | 74-39-5 | Molecular Weight | 259.218 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 509.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C12H9N3O4 | Melting Point | 195-200 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 261.7±25.4 °C | |
| Name | 4-(4-nitrophenylazo)resorcinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.2±33.0 °C at 760 mmHg |
| Melting Point | 195-200 °C (dec.)(lit.) |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.218 |
| Flash Point | 261.7±25.4 °C |
| Exact Mass | 259.059296 |
| PSA | 111.00000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | NGPGYVQZGRJHFJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(O)cc2O)cc1 |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | VH2810000 |
| HS Code | 2927000090 |
|
~86%
Magneson CAS#:74-39-5 |
| Literature: Valizadeh; Amiri; Shomali; Hosseinzadeh Journal of the Iranian Chemical Society, 2011 , vol. 8, # 2 p. 495 - 501 |
|
~92%
Magneson CAS#:74-39-5 |
| Literature: Valizadeh, Hassan; Amiri, Mohammad; Hosseinzadeh, Fatemeh Dyes and Pigments, 2012 , vol. 92, # 3 p. 1308 - 1313 |
|
~%
Magneson CAS#:74-39-5 |
| Literature: Journal of Organic Chemistry, , vol. 59, # 9 p. 2409 - 2417 |
|
~%
Magneson CAS#:74-39-5 |
| Literature: Journal of the Chemical Society, , vol. 93, p. 1020 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[(4-nitrophenyl)diazenyl]benzene-1,3-diol |
| 4-(4-Nitrophenylazo)resorcinol |
| 4-(4-Nitrophenyl)azoresorcinol |
| p-Diazoviolet |
| 1,3-Benzenediol, 4-[2-(4-nitrophenyl)diazenyl]- |
| Magnezon I |
| 4-[(4-Nitrophenyl)diazenyl]-1,3-benzenediol |
| p-Nitrobenzeneazoresorcinol |
| EINECS 200-808-5 |
| p-Diazviolet |
| Magneson I |
| azoviolet |
| MFCD00007310 |