[2-(4-bromophenyl)-2-oxo-ethyl] 2-hydroxyacetate structure
|
Common Name | [2-(4-bromophenyl)-2-oxo-ethyl] 2-hydroxyacetate | ||
|---|---|---|---|---|
| CAS Number | 7404-31-1 | Molecular Weight | 273.08000 | |
| Density | 1.595g/cm3 | Boiling Point | 408.4ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | [2-(4-bromophenyl)-2-oxoethyl] 2-hydroxyacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760 mmHg |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08000 |
| Flash Point | 200.8ºC |
| Exact Mass | 271.96800 |
| PSA | 63.60000 |
| LogP | 1.16730 |
| Index of Refraction | 1.574 |
| InChIKey | CKIVALMKXYYBKD-UHFFFAOYSA-N |
| SMILES | O=C(CO)OCC(=O)c1ccc(Br)cc1 |
|
~81%
[2-(4-bromophen... CAS#:7404-31-1 |
| Literature: Vegad, Hiran; Lobell, Mario; Bornemann, Stephen; Crout, David H.G. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 15 p. 2317 - 2324 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Bromphenacylester der Glycolsaeure |
| Glycolic acid p-bromophenacyl ester |
| Glykolsaeure-<p-brom-phenacyl>-ester |