Ethanone,1,1'-[1,2-ethanediylbis(6-hydroxy-6-methyl-3-nitro-3,1-cyclohexanediyl)]bis- (9CI) structure
|
Common Name | Ethanone,1,1'-[1,2-ethanediylbis(6-hydroxy-6-methyl-3-nitro-3,1-cyclohexanediyl)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7404-76-4 | Molecular Weight | 428.47700 | |
| Density | 1.28g/cm3 | Boiling Point | 600ºC at 760mmHg | |
| Molecular Formula | C20H32N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | 1-[5-[2-(3-acetyl-4-hydroxy-4-methyl-1-nitrocyclohexyl)ethyl]-2-hydroxy-2-methyl-5-nitrocyclohexyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 600ºC at 760mmHg |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.47700 |
| Flash Point | 231ºC |
| Exact Mass | 428.21600 |
| PSA | 166.24000 |
| LogP | 3.12420 |
| Index of Refraction | 1.545 |
| InChIKey | NADCXHBOGQIGCF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC(CCC2([N+](=O)[O-])CCC(C)(O)C(C(C)=O)C2)([N+](=O)[O-])CCC1(C)O |
|
~%
Ethanone,1,1'-[... CAS#:7404-76-4 |
| Literature: Feuer,H.; Harmetz,R. Journal of Organic Chemistry, 1961 , vol. 26, p. 1061 - 1072 |
| 1,2-Bis-(1'-nitro-3'-acetyl-4'-hydroxy-4'-methyl-cyclohexyl)-ethan |