1-[5-[2-(3-acetyl-4-methyl-1-nitro-1-cyclohex-3-enyl)ethyl]-2-methyl-5-nitro-1-cyclohexenyl]ethanone structure
|
Common Name | 1-[5-[2-(3-acetyl-4-methyl-1-nitro-1-cyclohex-3-enyl)ethyl]-2-methyl-5-nitro-1-cyclohexenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 7404-80-0 | Molecular Weight | 392.44600 | |
| Density | 1.21g/cm3 | Boiling Point | 566.5ºC at 760 mmHg | |
| Molecular Formula | C20H28N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | 1-[5-[2-(3-acetyl-4-methyl-1-nitrocyclohex-3-en-1-yl)ethyl]-2-methyl-5-nitrocyclohexen-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 566.5ºC at 760 mmHg |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.44600 |
| Flash Point | 254.9ºC |
| Exact Mass | 392.19500 |
| PSA | 125.78000 |
| LogP | 5.02280 |
| Index of Refraction | 1.54 |
| InChIKey | LSYLXJKNHAOQKI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C)CCC(CCC2([N+](=O)[O-])CCC(C)=C(C(C)=O)C2)([N+](=O)[O-])C1 |
|
~%
1-[5-[2-(3-acet... CAS#:7404-80-0 |
| Literature: Feuer,H.; Harmetz,R. Journal of Organic Chemistry, 1961 , vol. 26, p. 1061 - 1072 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2-Bis-(1'-nitro-3'-acetyl-4'-methyl-1'-cyclohexenyl)-aethan |