β-Casomorphin (1-4) amide (bovine) acetate salt structure
|
Common Name | β-Casomorphin (1-4) amide (bovine) acetate salt | ||
|---|---|---|---|---|
| CAS Number | 74135-04-9 | Molecular Weight | 521.60800 | |
| Density | 1.327±0.06 g/cm3(Predicted) | Boiling Point | 919.9±65.0 °C(Predicted) | |
| Molecular Formula | C28H35N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-Casomorphin (1-4) amide (bovine) acetate saltMorphiceptin is a potent and specific agonist for morphine (μ) receptors. Morphiceptin, as a synthetic peptide, is the amide of a fragment of the milk protein β-casein. Morphiceptin has morphinelike activities and is highly specific for morphine (μ) receptors but not for enkephalin (⸹) receptors[1]. |
| Name | Tyr-Pro-Phe-Pro-NH2 |
|---|---|
| Synonym | More Synonyms |
| Description | Morphiceptin is a potent and specific agonist for morphine (μ) receptors. Morphiceptin, as a synthetic peptide, is the amide of a fragment of the milk protein β-casein. Morphiceptin has morphinelike activities and is highly specific for morphine (μ) receptors but not for enkephalin (⸹) receptors[1]. |
|---|---|
| Related Catalog | |
| Target |
Morphine (μ) Receptor[1] |
| In Vivo | Morphiceptin potently inhibits the binding of [3H]dihydromorphine, 125I-labeled FK33824, and [3H]naloxone to rat brain membrane preparations with a 50 percent inhibition concentration (IC50) of about 20 nM[1]. |
| References |
| Density | 1.327±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 919.9±65.0 °C(Predicted) |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.60800 |
| Exact Mass | 521.26400 |
| PSA | 159.06000 |
| LogP | 2.12410 |
| InChIKey | LSQXZIUREIDSHZ-ZJZGAYNASA-N |
| SMILES | NC(=O)C1CCCN1C(=O)C(Cc1ccccc1)NC(=O)C1CCCN1C(=O)C(N)Cc1ccc(O)cc1 |
| Morphiceptin, Beta-Casomorphin (1-4) amide (bovine) |
| B-CASOMORPHIN (1-4) AMIDE (BOVINE) |
| cis-Morphiceptin |
| Beta-Casomorphin (1-4) amide (bovine).Morphiceptin |
| trans-Morphiceptin |
| morphicetin |
| morphiceptin |
| N-((R)-α-methylbenzyl)-3-aminopropan-1-ol |