[hydroxy-(4-methylphenoxy)phosphoryl]formic acid structure
|
Common Name | [hydroxy-(4-methylphenoxy)phosphoryl]formic acid | ||
|---|---|---|---|---|
| CAS Number | 74270-24-9 | Molecular Weight | 216.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [hydroxy-(4-methylphenoxy)phosphoryl]formic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9O5P |
|---|---|
| Molecular Weight | 216.12800 |
| Exact Mass | 216.01900 |
| PSA | 93.64000 |
| LogP | 2.23720 |
| InChIKey | WBBFNGNAIXHYMA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(O)C(=O)O)cc1 |
|
~81%
[hydroxy-(4-met... CAS#:74270-24-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
[hydroxy-(4-met... CAS#:74270-24-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-tolyl disodium oxycarbonylphosphonate |
| MePhPFA |
| VIS 059 |