N-(methylideneamino)-4-nitro-benzamide structure
|
Common Name | N-(methylideneamino)-4-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 7461-99-6 | Molecular Weight | 193.15900 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(methylideneamino)-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.15900 |
| Exact Mass | 193.04900 |
| PSA | 87.28000 |
| LogP | 1.85430 |
| Index of Refraction | 1.6 |
| InChIKey | IWSSSUFJBOVDGO-UHFFFAOYSA-N |
| SMILES | C=NNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
N-(methylidenea... CAS#:7461-99-6 |
| Literature: Chen Journal of the Chinese Chemical Society (Peking), 1935 , vol. 3, p. 251,253 |
|
~%
N-(methylidenea... CAS#:7461-99-6 |
| Literature: Chen Journal of the Chinese Chemical Society (Peking), 1935 , vol. 3, p. 251,253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-nitro-benzoic acid methylenehydrazide |
| 4-Nitro-benzoesaeure-methylenhydrazid |