N-(butylideneamino)-4-nitro-benzamide structure
|
Common Name | N-(butylideneamino)-4-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 7462-02-4 | Molecular Weight | 235.23900 | |
| Density | 1.223g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-butylideneamino]-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.23900 |
| Exact Mass | 235.09600 |
| PSA | 87.28000 |
| LogP | 3.02460 |
| Index of Refraction | 1.57 |
| InChIKey | LNPMGYGODXDGPS-XYOKQWHBSA-N |
| SMILES | CCCC=NNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~73%
N-(butylideneam... CAS#:7462-02-4 |
| Literature: Herrera, Raquel P.; Roca-Lopez, David; Navarro-Moros, Gloria European Journal of Organic Chemistry, 2010 , # 8 p. 1450 - 1454 |
|
~%
N-(butylideneam... CAS#:7462-02-4 |
| Literature: Chen Journal of the Chinese Chemical Society (Peking), 1935 , vol. 3, p. 251,253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| butyl p-nitrobenzoate |
| 4-nitrobenzoic acid n-butyl ester |
| 4-nitro-benzoic acid butyl ester |
| 4-nitro-benzoic acid butylidenehydrazide |
| n-Butyl 4-nitrobenzoate |
| 4-Nitro-benzoesaeure-butylester |
| 4-Nitro-benzoesaeure-butylidenhydrazid |
| butyl-4-nitrobenzoate |
| Benzoic acid,4-nitro-,butyl ester |