N-(cinnamylideneamino)-4-nitro-benzamide structure
|
Common Name | N-(cinnamylideneamino)-4-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 7462-08-0 | Molecular Weight | 295.29300 | |
| Density | 1.204g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(cinnamylideneamino)-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.29300 |
| Exact Mass | 295.09600 |
| PSA | 87.28000 |
| LogP | 3.93790 |
| Index of Refraction | 1.599 |
| InChIKey | QTVKDQALDDBVFH-FZHIPVGDSA-N |
| SMILES | O=C(NN=CC=Cc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
|
~%
N-(cinnamyliden... CAS#:7462-08-0 |
| Literature: Fischer Mikrochemie, 1933 , vol. 13, p. 123,128 Show Details Fischer; Moor Mikrochemie, 1934 , vol. 15, p. 79 Chem. Zentralbl., 1934 , vol. 105, # II p. 3654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Dimethyl-ethyl-carbinyl-p-nitrobenzoat |
| Ethyldimethylcarbionyl-p-nitrobenzoat |
| p-Nitro-benzoesaeure-1,1-dimethylpropylester |
| 2-Butanol,2-methyl-,2-(4-nitrobenzoate) |
| 4-nitro-benzoic acid tert-pentyl ester |
| trans-Zimtaldehyd-(4-nitro-benzoylhydrazon) |
| 4-nitro-benzoic acid trans-cinnamylidenehydrazide |
| 4-Nitro-benzoesaeure-trans-cinnamylidenhydrazid |
| 4-Nitro-benzoesaeure-tert-pentylester |