N-(2-chloroethyl)-3-methyl-5-nitro-imidazole-4-carboxamide
N-(2-chloroethyl)-3-methyl-5-nitro-imidazole-4-carboxamide structure
|
Common Name | N-(2-chloroethyl)-3-methyl-5-nitro-imidazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 7464-69-9 | Molecular Weight | 232.62400 | |
| Density | 1.57g/cm3 | Boiling Point | 520.7ºC at 760 mmHg | |
| Molecular Formula | C7H9ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.7ºC | |
Summary: N-(2-Chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide (CAS: 7464-69-9, molecular formula: C7H9ClN4O3, molecular weight: 232.62400), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 520.7ºC at 760 mmHg |
| Molecular Formula | C7H9ClN4O3 |
| Molecular Weight | 232.62400 |
| Flash Point | 268.7ºC |
| Exact Mass | 232.03600 |
| PSA | 92.74000 |
| LogP | 1.21100 |
| Index of Refraction | 1.638 |
| InChIKey | WFRQZFZIQRLMOT-UHFFFAOYSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1C(=O)NCCCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
N-(2-chloroethy... CAS#:7464-69-9 |
| Literature: Reznichenko; Aleksandrova; Kochergin Pharmaceutical Chemistry Journal, 2000 , vol. 34, # 8 p. 424 - 427 |
|
~%
N-(2-chloroethy... CAS#:7464-69-9 |
| Literature: Reznichenko; Aleksandrova; Kochergin Pharmaceutical Chemistry Journal, 2000 , vol. 34, # 8 p. 424 - 427 |
|
~%
N-(2-chloroethy... CAS#:7464-69-9 |
| Literature: Reznichenko; Aleksandrova; Kochergin Pharmaceutical Chemistry Journal, 2000 , vol. 34, # 8 p. 424 - 427 |
|
~%
N-(2-chloroethy... CAS#:7464-69-9 |
| Literature: Reznichenko; Aleksandrova; Kochergin Pharmaceutical Chemistry Journal, 2000 , vol. 34, # 8 p. 424 - 427 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: Molecular weight of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is 232.62400. |
| Q: What is the molecular formula of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: Molecular formula of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is C7H9ClN4O3. |
| Q: What is the LogP of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: LogP of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is 1.21100. |
| Q: What is the English name of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: The English name of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide. |
| Q: What is the SMILES notation of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: SMILES notation of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is Cn1cnc([N+](=O)[O-])c1C(=O)NCCCl. |
| Q: What is the polar surface area (PSA) of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: Polar surface area (PSA) of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is 92.74000. |
| Q: What is the InChIKey of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: InChIKey of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is WFRQZFZIQRLMOT-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: CAS number of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is 7464-69-9. |
| Q: What are the upstream materials of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: Related upstream materials(CAS) of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide: 61982-14-7;54828-05-6;89946-67-8. |
| Q: What is the boiling point of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide? |
| A: Boiling point of N-(2-chloroethyl)-3-methyl-5-nitroimidazole-4-carboxamide is 520.7ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |