Tetramethyluric acid structure
|
Common Name | Tetramethyluric acid | ||
|---|---|---|---|---|
| CAS Number | 2309-49-1 | Molecular Weight | 224.21700 | |
| Density | 1.48g/cm3 | Boiling Point | 295ºC at 760mmHg | |
| Molecular Formula | C9H12N4O3 | Melting Point | 226 ºC | |
| MSDS | N/A | Flash Point | 121.6ºC | |
| Name | 1,3,7,9-tetramethylpurine-2,6,8-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 295ºC at 760mmHg |
| Melting Point | 226 ºC |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.21700 |
| Flash Point | 121.6ºC |
| Exact Mass | 224.09100 |
| PSA | 70.93000 |
| Vapour Pressure | 0.00156mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | QGDOQULISIQFHQ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,7,9-tetramethyl-7,9-dihydro-3H-purine-2,6,8-trione |
| theacrine |
| Ba 2750 |
| Tetramethyl-harnsaeure |
| Temurin |
| Temorine |
| 1,3,7,9-Tetramethyluric acid |
| Tetramethyluric acid |