Benzoic acid,4-[2-(acetylamino)ethyl]- structure
|
Common Name | Benzoic acid,4-[2-(acetylamino)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 7465-13-6 | Molecular Weight | 207.22600 | |
| Density | N/A | Boiling Point | 473.6ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.2ºC | |
| Name | 4-(2-acetamidoethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 473.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 240.2ºC |
| Exact Mass | 207.09000 |
| PSA | 66.40000 |
| LogP | 1.45430 |
| InChIKey | GFUFUJMSZWBPNH-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCc1ccc(C(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzoic acid,4-... CAS#:7465-13-6 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
|
~%
Benzoic acid,4-... CAS#:7465-13-6 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2-Acetamino-aethyl)-benzoesaeure |
| 4-(2-Acetylamino-aethyl)-benzoesaeure |
| 4-[2-(acetylamino)ethyl]benzoic acid |