Benzoic acid,4-[(2-chloroacetyl)amino]-, ethyl ester structure
|
Common Name | Benzoic acid,4-[(2-chloroacetyl)amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 26226-72-2 | Molecular Weight | 241.67100 | |
| Density | 1.283g/cm3 | Boiling Point | 421.1ºC at 760mmHg | |
| Molecular Formula | C11H12ClNO3 | Melting Point | 110-114ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 208.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 4-[(2-chloroacetyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760mmHg |
| Melting Point | 110-114ºC(lit.) |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67100 |
| Flash Point | 208.5ºC |
| Exact Mass | 241.05100 |
| PSA | 55.40000 |
| LogP | 2.11360 |
| Vapour Pressure | 2.67E-07mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | ZVRJEYAQESBSSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCl)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
|
4-Thiazolidinones in heterocyclic synthesis: synthesis of novel enaminones, azolopyrimidines and 2-arylimino-5-arylidene-4-thiazolidinones.
Molecules 17(6) , 6362-85, (2012) The 4-thiazolidinones 3a-d were used as a key intermediates for the synthesis of 2-arylimino-5-arylidene-4-thiazolidinones derivatives 7a–p via nucleophilic addition reactions with the arylidene malon... |
| ethyl 4-[(chloroacetyl)amino]benzoate |
| MFCD00018909 |
| ethyl 4-(2-chloroacetylamino)benzoate |
| ethyl p-chloroacetylaminobenzoate |
| ethyl 4-chloroacetamidobenzoate |
| 4-(2-chloro-acetylamino)-benzoic acid ethyl ester |
| ethyl 4-(2-chloroacetamido)benzoate |
| 4-(2-Chlor-acetylamino)-benzoesaeure-aethylester |
| F3358-0383 |