2-(1-hydroxycyclohexyl)-3,4-dimethyl-pentanoic acid structure
|
Common Name | 2-(1-hydroxycyclohexyl)-3,4-dimethyl-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7465-27-2 | Molecular Weight | 228.32800 | |
| Density | 1.06g/cm3 | Boiling Point | 362.1ºC at 760 mmHg | |
| Molecular Formula | C13H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187ºC | |
| Name | 2-(1-hydroxycyclohexyl)-3,4-dimethylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 362.1ºC at 760 mmHg |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.32800 |
| Flash Point | 187ºC |
| Exact Mass | 228.17300 |
| PSA | 57.53000 |
| LogP | 2.67450 |
| Index of Refraction | 1.497 |
| InChIKey | XVDPCTZQBOQBKK-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)C(C(=O)O)C1(O)CCCCC1 |
|
~%
2-(1-hydroxycyc... CAS#:7465-27-2 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 5399 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(1-Hydroxy-cyclohexyl)-3,4-dimethyl-valeriansaeure |
| 2-(1-hydroxy-cyclohexyl)-3,4-dimethyl-valeric acid |