BIO-013077-01 structure
|
Common Name | BIO-013077-01 | ||
|---|---|---|---|---|
| CAS Number | 746667-48-1 | Molecular Weight | 287.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BIO-013077-01BIO-013077-01 is a pyrazole TGF-β inhibitor[1]. |
| Name | 6-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoxaline |
|---|---|
| Synonym | More Synonyms |
| Description | BIO-013077-01 is a pyrazole TGF-β inhibitor[1]. |
|---|---|
| Related Catalog | |
| In Vitro | A wide range of cellular functions such as cell proliferation, differentiation, adhesion, migration, and apoptosis are regulated by TGF-β superfamily members. The TGF-βs include the three major TGF-β isoforms, TGF-β1, TGF-β2, and TGF-β3 which are expressed in mammals. TGF-β transduces signals through a complex of two related but structurally and functionally distinct serine/threonine kinase receptors, termed type 1 and type II. Deregulation of TGF-β signaling has been also implicated in various human diseases including cancer, pancreatic diseases, and hematological malignancies[1]. |
| In Vivo | TGF-β Inhibitor |
| References |
| Molecular Formula | C17H13N5 |
|---|---|
| Molecular Weight | 287.31900 |
| Exact Mass | 287.11700 |
| PSA | 67.35000 |
| LogP | 3.39030 |
| InChIKey | VXJLYXCHOKEODY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccc3nccnc3c2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)quinoxaline |
| Quinoxaline |