2-(3,5-dinitrobenzoyl)oxy-2-methyl-propanoic acid structure
|
Common Name | 2-(3,5-dinitrobenzoyl)oxy-2-methyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7472-03-9 | Molecular Weight | 298.20600 | |
| Density | 1.527g/cm3 | Boiling Point | 517.2ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid |
|---|
| Density | 1.527g/cm3 |
|---|---|
| Boiling Point | 517.2ºC at 760 mmHg |
| Molecular Formula | C11H10N2O8 |
| Molecular Weight | 298.20600 |
| Flash Point | 266.6ºC |
| Exact Mass | 298.04400 |
| PSA | 155.24000 |
| LogP | 2.56940 |
| Index of Refraction | 1.597 |
| InChIKey | HJAXJFXYRLGRIV-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)O |
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |