2-(3,5-dinitrobenzoyl)oxy-2-methyl-propanoic acid
2-(3,5-dinitrobenzoyl)oxy-2-methyl-propanoic acid structure
|
Common Name | 2-(3,5-dinitrobenzoyl)oxy-2-methyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7472-03-9 | Molecular Weight | 298.20600 | |
| Density | 1.527g/cm3 | Boiling Point | 517.2ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.527g/cm3 |
|---|---|
| Boiling Point | 517.2ºC at 760 mmHg |
| Molecular Formula | C11H10N2O8 |
| Molecular Weight | 298.20600 |
| Flash Point | 266.6ºC |
| Exact Mass | 298.04400 |
| PSA | 155.24000 |
| LogP | 2.56940 |
| Index of Refraction | 1.597 |
| InChIKey | HJAXJFXYRLGRIV-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
|
~%
2-(3,5-dinitrob... CAS#:7472-03-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
![Propanal,2-[(3,5-dinitrobenzoyl)oxy]-2-methyl structure](https://image.chemsrc.com/caspic/245/7472-11-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:7472-01-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: Boiling point of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is 517.2ºC at 760 mmHg. |
| Q: What is the Chinese name of 7472-03-9? |
| A: Chinese name of 7472-03-9 is 7472-03-9. |
| Q: What is the English name of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: The English name of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid. |
| Q: What is the SMILES notation of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: SMILES notation of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is CC(C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)O. |
| Q: What is the CAS number of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: CAS number of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is 7472-03-9. |
| Q: What are the upstream materials of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: Related upstream materials(CAS) of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid: 7472-11-9;7472-04-0;99-33-2. |
| Q: What is the InChIKey of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: InChIKey of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is HJAXJFXYRLGRIV-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: LogP of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is 2.56940. |
| Q: What is the molecular weight of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: Molecular weight of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is 298.20600. |
| Q: What is the molecular formula of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid? |
| A: Molecular formula of 2-(3,5-dinitrobenzoyl)oxy-2-methylpropanoic acid is C11H10N2O8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |