Propanal,2-[(3,5-dinitrobenzoyl)oxy]-2-methyl- structure
|
Common Name | Propanal,2-[(3,5-dinitrobenzoyl)oxy]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7472-11-9 | Molecular Weight | 282.20600 | |
| Density | 1.426g/cm3 | Boiling Point | 443.2ºC at 760mmHg | |
| Molecular Formula | C11H10N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | (2-methyl-1-oxopropan-2-yl) 3,5-dinitrobenzoate |
|---|
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 443.2ºC at 760mmHg |
| Molecular Formula | C11H10N2O7 |
| Molecular Weight | 282.20600 |
| Flash Point | 202.4ºC |
| Exact Mass | 282.04900 |
| PSA | 135.01000 |
| LogP | 2.68370 |
| Index of Refraction | 1.572 |
| InChIKey | RMAJQOOUHLEVFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C=O)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
Propanal,2-[(3,... CAS#:7472-11-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
|
~%
Propanal,2-[(3,... CAS#:7472-11-9 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |