(1,1-dimethoxy-2-methyl-propan-2-yl) 3,5-dinitrobenzoate structure
|
Common Name | (1,1-dimethoxy-2-methyl-propan-2-yl) 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-04-0 | Molecular Weight | 328.27500 | |
| Density | 1.33g/cm3 | Boiling Point | 389ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
| Name | (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760 mmHg |
| Molecular Formula | C13H16N2O8 |
| Molecular Weight | 328.27500 |
| Flash Point | 147.8ºC |
| Exact Mass | 328.09100 |
| PSA | 136.40000 |
| LogP | 3.10370 |
| Index of Refraction | 1.542 |
| InChIKey | AMNFAFCWOFXWHY-UHFFFAOYSA-N |
| SMILES | COC(OC)C(C)(C)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
(1,1-dimethoxy-... CAS#:7472-04-0 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
| 3,5-dinitro-benzoic acid-(2,2-dimethoxy-1,1-dimethyl-ethyl ester) |
| 3,5-Dinitro-benzoesaeure-(2,2-dimethoxy-1,1-dimethyl-aethylester) |