(1,1-dimethoxy-2-methyl-propan-2-yl) 3,5-dinitrobenzoate
(1,1-dimethoxy-2-methyl-propan-2-yl) 3,5-dinitrobenzoate structure
|
Common Name | (1,1-dimethoxy-2-methyl-propan-2-yl) 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-04-0 | Molecular Weight | 328.27500 | |
| Density | 1.33g/cm3 | Boiling Point | 389ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760 mmHg |
| Molecular Formula | C13H16N2O8 |
| Molecular Weight | 328.27500 |
| Flash Point | 147.8ºC |
| Exact Mass | 328.09100 |
| PSA | 136.40000 |
| LogP | 3.10370 |
| Index of Refraction | 1.542 |
| InChIKey | AMNFAFCWOFXWHY-UHFFFAOYSA-N |
| SMILES | COC(OC)C(C)(C)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(1,1-dimethoxy-... CAS#:7472-04-0 |
| Literature: Stevens; Gillis Journal of the American Chemical Society, 1957 , vol. 79, p. 3448,3449 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:7472-01-7
CAS#:7472-03-9![Propanal,2-[(3,5-dinitrobenzoyl)oxy]-2-methyl structure](https://image.chemsrc.com/caspic/245/7472-11-9.png)
CAS#:7472-11-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-dinitro-benzoic acid-(2,2-dimethoxy-1,1-dimethyl-ethyl ester) |
| 3,5-Dinitro-benzoesaeure-(2,2-dimethoxy-1,1-dimethyl-aethylester) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: CAS number of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is 7472-04-0. |
| Q: What are the upstream materials of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: Related upstream materials(CAS) of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate: 99-33-2. |
| Q: What is the English name of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: The English name of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate. |
| Q: What is the SMILES notation of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: SMILES notation of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is COC(OC)C(C)(C)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1. |
| Q: What is the polar surface area (PSA) of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: Polar surface area (PSA) of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is 136.40000. |
| Q: What is the Chinese name of 7472-04-0? |
| A: Chinese name of 7472-04-0 is 7472-04-0. |
| Q: What is the boiling point of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: Boiling point of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is 389ºC at 760 mmHg. |
| Q: What is the LogP of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: LogP of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is 3.10370. |
| Q: What is the molecular formula of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: Molecular formula of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate is C13H16N2O8. |
| Q: What are the downstream products of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate? |
| A: Related downstream products(CAS) of (1,1-dimethoxy-2-methylpropan-2-yl) 3,5-dinitrobenzoate: 7472-01-7;7472-03-9;7472-11-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |