(4-acetyloxy-2,5-dichloro-3,6-dioxo-1-cyclohexa-1,4-dienyl) acetate
(4-acetyloxy-2,5-dichloro-3,6-dioxo-1-cyclohexa-1,4-dienyl) acetate structure
|
Common Name | (4-acetyloxy-2,5-dichloro-3,6-dioxo-1-cyclohexa-1,4-dienyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 7474-87-5 | Molecular Weight | 293.05700 | |
| Density | 1.58g/cm3 | Boiling Point | 361.6ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 361.6ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2O6 |
| Molecular Weight | 293.05700 |
| Flash Point | 149.7ºC |
| Exact Mass | 291.95400 |
| PSA | 86.74000 |
| LogP | 1.16520 |
| Index of Refraction | 1.548 |
| InChIKey | DEOHGEJYLQIBEB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(Cl)C(=O)C(OC(C)=O)=C(Cl)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(4-acetyloxy-2,... CAS#:7474-87-5 |
| Literature: Nef American Chemical Journal, 1890 , vol. 12, p. 484 Journal fuer Praktische Chemie (Leipzig), 1890 , vol. <2> 42, p. 184 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:5030-67-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,6-Dichlor-2,5-diacetoxy-benzochinon-(1,4) |
| 2,5-Diacetoxy-3,6-dichlor-[1,4]benzochinon |
| 2,5-diacetoxy-3,6-dichloro-[1,4]benzoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: Molecular weight of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is 293.05700. |
| Q: What is the InChIKey of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: InChIKey of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is DEOHGEJYLQIBEB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: Molecular formula of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is C10H6Cl2O6. |
| Q: What are the upstream materials of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: Related upstream materials(CAS) of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate: 75-36-5. |
| Q: What English synonyms does (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate have? |
| A: English synonyms of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate: 3,6-Dichlor-2,5-diacetoxy-benzochinon-(1,4), 2,5-Diacetoxy-3,6-dichlor-[1,4]benzochinon, 2,5-diacetoxy-3,6-dichloro-[1,4]benzoquinone. |
| Q: What is the Chinese name of 7474-87-5? |
| A: Chinese name of 7474-87-5 is 7474-87-5. |
| Q: What is the SMILES notation of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: SMILES notation of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is CC(=O)OC1=C(Cl)C(=O)C(OC(C)=O)=C(Cl)C1=O. |
| Q: What is the English name of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: The English name of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate. |
| Q: What is the LogP of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: LogP of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is 1.16520. |
| Q: What is the CAS number of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate? |
| A: CAS number of (4-acetyloxy-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl) acetate is 7474-87-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |