3,5-Dinitro-2-hydroxybenzoic acid structure
|
Common Name | 3,5-Dinitro-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 609-99-4 | Molecular Weight | 228.116 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 387.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O7 | Melting Point | 170 °C | |
| MSDS | Chinese USA | Flash Point | 173.8±16.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,5-dinitrosalicylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.2±42.0 °C at 760 mmHg |
| Melting Point | 170 °C |
| Molecular Formula | C7H4N2O7 |
| Molecular Weight | 228.116 |
| Flash Point | 173.8±16.3 °C |
| Exact Mass | 228.001846 |
| PSA | 149.17000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | LWFUFLREGJMOIZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| Storage condition | Refrigerator |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases, strong acids. |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H335 |
| Precautionary Statements | P261 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | VO2965000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2916399090 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
The influence of pretreatment methods on saccharification of sugarcane bagasse by an enzyme extract from Chrysoporthe cubensis and commercial cocktails: A comparative study.
Bioresour. Technol. 192 , 670-6, (2015) Biomass enzymatic hydrolysis depends on the pretreatment methods employed, the composition of initial feedstock and the enzyme cocktail used to release sugars for subsequent fermentation into ethanol.... |
|
|
Size and molecular flexibility of sugars determine the storage stability of freeze-dried proteins.
Mol. Pharm. 12(3) , 684-94, (2015) Protein-based biopharmaceuticals are generally produced as aqueous solutions and stored refrigerated to obtain sufficient shelf life. Alternatively, proteins may be freeze-dried in the presence of sug... |
|
|
Susceptibility of glutinous rice starch to digestive enzymes.
Carbohydr. Polym. 128 , 154-62, (2015) To understand the susceptibility of glutinous rice starch to digestive enzymes and its potential impact on glycemic response, enzyme kinetics and in vitro digestibility of the native and gelatinized s... |
| Benzoic acid, 2-hydroxy-3,5-dinitro- |
| 3,5-Dinitrosalicylic acid |
| EINECS 210-204-3 |
| 3,5-Dinitrosalicylate |
| 2-Hydroxy-3,5-dinitrobenzoic acid |
| MFCD00149501 |