4,4'-[1,10-Decanediylbis(oxy)]dibenzoic acid structure
|
Common Name | 4,4'-[1,10-Decanediylbis(oxy)]dibenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 74774-61-1 | Molecular Weight | 414.491 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 591.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C24H30O6 | Melting Point | 274ºC | |
| MSDS | N/A | Flash Point | 198.4±16.7 °C | |
| Name | 1,10-Bis(4-carboxyphenoxy)decane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.9±25.0 °C at 760 mmHg |
| Melting Point | 274ºC |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.491 |
| Flash Point | 198.4±16.7 °C |
| Exact Mass | 414.204254 |
| PSA | 93.06000 |
| LogP | 7.41 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | XRDKWFXOXXUQJS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCCCCCCCCCCOc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~94%
4,4'-[1,10-Deca... CAS#:74774-61-1 |
| Literature: Zhang, Haiping; Jakisch, Lothar; Komber, Hartmut; Voit, Brigitte; Boehme, Frank Tetrahedron, 2013 , vol. 69, # 18 p. 3656 - 3663 |
|
~%
4,4'-[1,10-Deca... CAS#:74774-61-1 |
| Literature: Molecular Crystals and Liquid Crystals (1969-1991), , vol. 162, p. 277 - 282 |
|
~%
4,4'-[1,10-Deca... CAS#:74774-61-1 |
| Literature: Molecular Crystals and Liquid Crystals (1969-1991), , vol. 162, p. 277 - 282 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-[Decane-1,10-diylbis(oxy)]dibenzoic acid |
| 4-[10-(4-carboxyphenoxy)decoxy]benzoic acid |
| 4,4'-[1,10-Decanediylbis(oxy)]dibenzoic acid |
| Benzoic acid, 4,4'-[1,10-decanediylbis(oxy)]bis- |