Diethyl 4,4'-[1,10-decanediylbis(oxy)]dibenzoate structure
|
Common Name | Diethyl 4,4'-[1,10-decanediylbis(oxy)]dibenzoate | ||
|---|---|---|---|---|
| CAS Number | 103330-20-7 | Molecular Weight | 470.598 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 582.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C28H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.1±23.2 °C | |
| Name | 1,10-Bis[4-(ethoxycarbonyl)phenoxy]decane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.1±25.0 °C at 760 mmHg |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.598 |
| Flash Point | 245.1±23.2 °C |
| Exact Mass | 470.266846 |
| PSA | 71.06000 |
| LogP | 9.10 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | PSGYTOLXVIWDFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCCCCCCCCCCOc2ccc(C(=O)OCC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~88%
Diethyl 4,4'-[1... CAS#:103330-20-7 |
| Literature: Liu, Shu; Lee, Sang-Hun; Shen, Ya Xi; Gibson, Harry W. Journal of Organic Chemistry, 1995 , vol. 60, # 10 p. 3155 - 3162 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 4-[10-(4-ethoxycarbonylphenoxy)decoxy]benzoate |
| Diethyl 4,4'-[1,10-decanediylbis(oxy)]dibenzoate |
| Diethyl 4,4'-[decane-1,10-diylbis(oxy)]dibenzoate |
| p,p'-Bis(ethoxycarbonyl)-1,10-diphenoxydecane |
| Benzoic acid, 4,4'-[1,10-decanediylbis(oxy)]bis-, diethyl ester |