2-Chloro-3-nitro-5-picoline structure
|
Common Name | 2-Chloro-3-nitro-5-picoline | ||
|---|---|---|---|---|
| CAS Number | 23056-40-8 | Molecular Weight | 172.569 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 290.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O2 | Melting Point | 46-50 °C | |
| MSDS | Chinese USA | Flash Point | 129.7±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
Use of 2-Chloro-3-nitro-5-picoline |
| Name | 2-Chloro-5-methyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.8±35.0 °C at 760 mmHg |
| Melting Point | 46-50 °C |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.569 |
| Flash Point | 129.7±25.9 °C |
| Exact Mass | 172.003952 |
| PSA | 58.71000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | LUAJUWOJEFFNFE-UHFFFAOYSA-N |
| SMILES | Cc1cnc(Cl)c([N+](=O)[O-])c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~95%
2-Chloro-3-nitr... CAS#:23056-40-8 |
| Literature: Ahn, Sung Oh; Park, Chan Hee; Im, Jun Hwan; Lee, Soon Ok; Lee, Kyoung June; Cho, Seong Wook; Ko, Kwang Seok; Han, Sun Young; Lee, Won Il Patent: US2011/28467 A1, 2011 ; Location in patent: Page/Page column 51 ; US 20110028467 A1 |
|
~%
2-Chloro-3-nitr... CAS#:23056-40-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 13 p. 3983 - 3987 |
|
~%
2-Chloro-3-nitr... CAS#:23056-40-8 |
| Literature: EP2366691 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-5-methyl-3-nitropyridine |
| MFCD02070020 |
| 6-Chloro-5-nitro-3-picoline |
| 2-Chlor-3-nitro-5-methyl-pyridin |
| 2-Chloro-5-Methyl-3-Nitro Pyridine |
| 2-Chloro-3-nitro-5-picoline |
| 2-chloro-3-nitro-5-methylpyridine |
| Pyridine, 2-chloro-5-methyl-3-nitro- |
| 2-Chlor-5-methyl-3-nitro-pyridin |
| 2-Chloro-5-methyl-3-nitro-pyridine |