Benzoic acid,2-(2-hydroxybenzoyl)-, ethyl ester structure
|
Common Name | Benzoic acid,2-(2-hydroxybenzoyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7494-43-1 | Molecular Weight | 270.28000 | |
| Density | 1.226g/cm3 | Boiling Point | 380.4ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(2-hydroxybenzoyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 380.4ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 63.60000 |
| LogP | 2.79990 |
| Index of Refraction | 1.589 |
| InChIKey | SLQRLJDRKMGXJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1C(=O)c1ccccc1O |
|
~47%
Benzoic acid,2-... CAS#:7494-43-1 |
| Literature: Shan, Gang; Han, Xuesong; Lin, Yun; Yu, Shanyou; Rao, Yu Organic and Biomolecular Chemistry, 2013 , vol. 11, # 14 p. 2318 - 2322 |
|
~%
Benzoic acid,2-... CAS#:7494-43-1 |
| Literature: Bayer and Co. Patent: DE269336 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 1170 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-salicyloyl-benzoic acid ethyl ester |
| 2-(2-Oxy-benzoyl)-benzoesaeureaethylester |
| ethyl 2-[(2-hydroxyphenyl)carbonyl]benzoate |
| 2-Salicyloyl-benzoesaeure-aethylester |