3-(4-Chlorophenyl)-3-methylnaphtho(1,2-c)furan-1(3H)-one structure
|
Common Name | 3-(4-Chlorophenyl)-3-methylnaphtho(1,2-c)furan-1(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 7496-11-9 | Molecular Weight | 308.75800 | |
| Density | 1.315g/cm3 | Boiling Point | 498.5ºC at 760 mmHg | |
| Molecular Formula | C19H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.7ºC | |
| Name | 3-(4-chlorophenyl)-3-methylbenzo[g][2]benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 498.5ºC at 760 mmHg |
| Molecular Formula | C19H13ClO2 |
| Molecular Weight | 308.75800 |
| Flash Point | 276.7ºC |
| Exact Mass | 308.06000 |
| PSA | 26.30000 |
| LogP | 4.92710 |
| Index of Refraction | 1.666 |
| InChIKey | LRDHDYIGTGAHMH-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc(Cl)cc2)OC(=O)c2c1ccc1ccccc21 |
|
~%
3-(4-Chlorophen... CAS#:7496-11-9 |
| Literature: Newman; Orchin Journal of the American Chemical Society, 1938 , vol. 60, p. 586,588 |
|
~%
3-(4-Chlorophen... CAS#:7496-11-9 |
| Literature: Newman; Orchin Journal of the American Chemical Society, 1938 , vol. 60, p. 586,588 |
|
~%
3-(4-Chlorophen... CAS#:7496-11-9 |
| Literature: Newman; Orchin Journal of the American Chemical Society, 1938 , vol. 60, p. 586,588 |
| 3-(4-chloro-phenyl)-3-methyl-3H-naphtho[1,2-c]furan-1-one |
| 3-(4-Chlor-phenyl)-3-methyl-3H-naphtho[1,2-c]furan-1-on |
| 3-(4-Chlorophenyl)-3-methylnaphtho(1,2-c)furan-1(3H)-one |