[2-oxo-2-(4-phenylphenyl)ethyl] 2-benzamidoacetate structure
|
Common Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-benzamidoacetate | ||
|---|---|---|---|---|
| CAS Number | 7497-81-6 | Molecular Weight | 373.40100 | |
| Density | 1.214g/cm3 | Boiling Point | 623.5ºC at 760 mmHg | |
| Molecular Formula | C23H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.9ºC | |
| Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-benzamidoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 623.5ºC at 760 mmHg |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.40100 |
| Flash Point | 330.9ºC |
| Exact Mass | 373.13100 |
| PSA | 72.47000 |
| LogP | 3.90040 |
| Index of Refraction | 1.599 |
| InChIKey | UJFRCKIPWCUVGB-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)c1ccccc1)OCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
[2-oxo-2-(4-phe... CAS#:7497-81-6 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
[2-oxo-2-(4-phe... CAS#:7497-81-6 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
[2-oxo-2-(4-phe... CAS#:7497-81-6 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Hippursaeure |