Methanone,bis(4-chloro-3-nitrophenyl) structure
|
Common Name | Methanone,bis(4-chloro-3-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 7498-65-9 | Molecular Weight | 341.10300 | |
| Density | 1.585g/cm3 | Boiling Point | 521.9ºC at 760mmHg | |
| Molecular Formula | C13H6Cl2N2O5 | Melting Point | 132-134ºC(lit.) | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | bis(4-chloro-3-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 521.9ºC at 760mmHg |
| Melting Point | 132-134ºC(lit.) |
| Molecular Formula | C13H6Cl2N2O5 |
| Molecular Weight | 341.10300 |
| Flash Point | 269.4ºC |
| Exact Mass | 339.96500 |
| PSA | 108.71000 |
| LogP | 5.08720 |
| Index of Refraction | 1.654 |
| InChIKey | SOJWEAJNHAWZTG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi,N |
|---|---|
| Risk Phrases | 41-50 |
| Safety Phrases | S26-S39-S61 |
| RIDADR | UN 3077 9/PG 3 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
|
Name: Ability to inhibit expression of Vascular cell adhesion molecule 1
Source: ChEMBL
Target: Vascular cell adhesion protein 1
External Id: CHEMBL818222
|
| 4,4'-dichloro-3,3'-dinitro-benzophenone |
| 3,3'-dinitro-4,4'-dichloro benzophenone |
| 4,4'-Dichlor-3,3'-dinitro-benzophenon |
| T0514-2521 |