Benzeneacetic acid,4-methyl-a-(trichloromethyl)- structure
|
Common Name | Benzeneacetic acid,4-methyl-a-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7504-36-1 | Molecular Weight | 267.53600 | |
| Density | 1.449g/cm3 | Boiling Point | 304.9ºC at 760mmHg | |
| Molecular Formula | C10H9Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.2ºC | |
| Name | 3,3,3-trichloro-2-(4-methylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 304.9ºC at 760mmHg |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.53600 |
| Flash Point | 138.2ºC |
| Exact Mass | 265.96700 |
| PSA | 37.30000 |
| LogP | 3.53340 |
| Index of Refraction | 1.578 |
| InChIKey | LSVNTHGUMBEXII-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C(=O)O)C(Cl)(Cl)Cl)cc1 |
|
~%
Benzeneacetic a... CAS#:7504-36-1 |
| Literature: Tse; Newman Journal of Organic Chemistry, 1956 , vol. 21, p. 638 |
|
~%
Benzeneacetic a... CAS#:7504-36-1 |
| Literature: v. Auwers; Juelicher Chemische Berichte, 1922 , vol. 55, p. 2185 |
|
~%
Benzeneacetic a... CAS#:7504-36-1 |
| Literature: v. Auwers; Juelicher Chemische Berichte, 1922 , vol. 55, p. 2185 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,3,3-Trichlor-2-p-tolyl-propionsaeure |
| 3,3,3-trichloro-2-p-tolyl-propionic acid |