2,3-bis(4-chlorophenyl)-1,4-dioxane structure
|
Common Name | 2,3-bis(4-chlorophenyl)-1,4-dioxane | ||
|---|---|---|---|---|
| CAS Number | 7504-91-8 | Molecular Weight | 309.18700 | |
| Density | 1.283g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C16H14Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
| Name | 2,3-bis(4-chlorophenyl)-1,4-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.18700 |
| Flash Point | 148ºC |
| Exact Mass | 308.03700 |
| PSA | 18.46000 |
| LogP | 4.82260 |
| Index of Refraction | 1.581 |
| InChIKey | ROPBIZIYEZEHIP-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2OCCOC2c2ccc(Cl)cc2)cc1 |
|
~%
2,3-bis(4-chlor... CAS#:7504-91-8 |
| Literature: Summerbell; Bauer Journal of the American Chemical Society, 1935 , vol. 57, p. 2364,2366 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-Bis-<4-chlor-phenyl>-1,4-dioxan |