1-nitro-4-(2-nitro-2-phenyl-ethenyl)benzene structure
|
Common Name | 1-nitro-4-(2-nitro-2-phenyl-ethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 7504-96-3 | Molecular Weight | 270.24000 | |
| Density | 1.347g/cm3 | Boiling Point | 391.6ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 1-nitro-4-[(Z)-2-nitro-2-phenylethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 391.6ºC at 760 mmHg |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24000 |
| Flash Point | 180.6ºC |
| Exact Mass | 270.06400 |
| PSA | 91.64000 |
| LogP | 4.41600 |
| Index of Refraction | 1.669 |
| InChIKey | FQQMTUFHLMVNKU-UVTDQMKNSA-N |
| SMILES | O=[N+]([O-])C(=Cc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~75%
1-nitro-4-(2-ni... CAS#:7504-96-3 |
| Literature: Bandgar; Kasture Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 12 p. 1239 - 1241 |
|
~%
1-nitro-4-(2-ni... CAS#:7504-96-3 |
| Literature: Nikolaeva,A.D. et al. Zhurnal Organicheskoi Khimii, 1971 , vol. 7, # 8 p. 1670 - 1672,1734 - 1736 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Nitro-2-(p-nitrophenyl)-1-phenylethylen |