Rolitetracycline structure
|
Common Name | Rolitetracycline | ||
|---|---|---|---|---|
| CAS Number | 751-97-3 | Molecular Weight | 527.57 | |
| Density | 1.542g/cm3 | Boiling Point | 824.37ºC at 760 mmHg | |
| Molecular Formula | C27H33N3O8 | Melting Point | 163.5°C | |
| MSDS | Chinese USA | Flash Point | 452.363ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of RolitetracyclineRolitetracycline, a derivative of tetracycline, is a broad-spectrum antibiotic[1][2]. Rolitetracyclin has a role as a protein synthesis inhibitor, an antiprotozoal drug and a prodrug[3]. |
| Name | rolitetracycline |
|---|---|
| Synonym | More Synonyms |
| Description | Rolitetracycline, a derivative of tetracycline, is a broad-spectrum antibiotic[1][2]. Rolitetracyclin has a role as a protein synthesis inhibitor, an antiprotozoal drug and a prodrug[3]. |
|---|---|
| Related Catalog | |
| References |
[2]. Rolitetracycline |
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 824.37ºC at 760 mmHg |
| Melting Point | 163.5°C |
| Molecular Formula | C27H33N3O8 |
| Molecular Weight | 527.57 |
| Flash Point | 452.363ºC |
| Exact Mass | 527.22700 |
| PSA | 170.87000 |
| LogP | 0.79860 |
| Index of Refraction | 1.713 |
| InChIKey | IKQRPFTXKQQLJF-IAHYZSEUSA-N |
| SMILES | CN(C)C1C(=O)C(C(=O)NCN2CCCC2)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12 |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | QI9150000 |
|
~%
Rolitetracycline CAS#:751-97-3 |
| Literature: Muench. med. Wschr., , vol. 100, p. 661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Reversed-phase high-performance liquid chromatography coupled to ultraviolet and electrospray time-of-flight mass spectrometry on-line detection for the separation of eight tetracyclines in honey samples.
J. Chromatogr. A. 1195(1-2) , 107-16, (2008) Eight antibiotics, chlortetracycline, demeclocycline, doxycycline, methacycline, minocycline, oxytetracycline, tetracycline and rolitetracycline, were separated and quantified in Spanish honey extract... |
|
|
Sclerotherapy for hydroceles.
J. Urol. 143(5) , 940-3, (1990) Sclerotherapy with 3% sodium tetradecyl sulfate and 3.5% rolitetracycline on an outpatient basis was applied to 55 hydroceles. The over-all cure rate was 96% with an average followup of 13 months. Of ... |
|
|
Trichloroacetic acid in Norway spruce/soil-system. II. Distribution and degradation in the plant.
Chemosphere 56(4) , 327-33, (2004) Independently from its origin, trichloroacetic acid (TCA) as a phytotoxic substance affects coniferous trees. Its uptake, distribution and degradation were thus investigated in the Norway spruce/soil-... |
| synotodecin |
| rolitetracyclin |
| sq15,659 |
| Syntodecin |
| ROLITETRACYCLINE |
| prm-tc |
| Transcycline |
| superciclin |
| syntetrin |
| N-pyrrolidinomethyl-tetracycline |
| bristacin |
| syntetrex |
| reverin |
| N-Pyrrolidinomethyl-tetracyclin |
| velacicline |