4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxy-phenol structure
|
Common Name | 4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxy-phenol | ||
|---|---|---|---|---|
| CAS Number | 7510-71-6 | Molecular Weight | 316.26600 | |
| Density | 1.445g/cm3 | Boiling Point | 473.9ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.4ºC | |
| Name | 4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 473.9ºC at 760 mmHg |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.26600 |
| Flash Point | 240.4ºC |
| Exact Mass | 316.07000 |
| PSA | 121.10000 |
| LogP | 4.43400 |
| Index of Refraction | 1.708 |
| InChIKey | YGDVHZZZOGFPNF-UHFFFAOYSA-N |
| SMILES | COc1cc(C=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1O |
|
~70%
4-[2-(2,4-dinit... CAS#:7510-71-6 |
| Literature: Hanson, James R.; Hitchcock, Peter B.; Saberi, Hamid Journal of Chemical Research, 2004 , # 10 p. 667 - 669 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methoxy-4-(2,4-dinitro-styryl)-phenol |
| 2'.4'-Dinitro-4-oxy-3-methoxy-stilben |
| Methyl-(2',4'-dinitro-4-hydroxy-stilbenyl-(3))-aether |
| Benzenamine,2-methoxy-4-(1-methyl-4-piperidinyl) |
| tert-butyl N-[2-methoxy-4-(1-methyl-4-piperidyl)phenyl]carbamate |
| 2-methoxy-4-(1-methylpiperid-4-yl)phenylamine |
| 2',4'-Dinitro-4-hydroxy-3-methoxy-stilben |
| 2,4-dinitro-4'-hydroxy-3'-methoxystilbene |