1,1,2,2,3,3,4,4-octafluoro-1-iodobutane
1,1,2,2,3,3,4,4-octafluoro-1-iodobutane structure
|
Common Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane | ||
|---|---|---|---|---|
| CAS Number | 754-73-4 | Molecular Weight | 327.94200 | |
| Density | 2.082g/cm3 | Boiling Point | 85ºC | |
| Molecular Formula | C4HF8I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 27.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.082g/cm3 |
|---|---|
| Boiling Point | 85ºC |
| Molecular Formula | C4HF8I |
| Molecular Weight | 327.94200 |
| Flash Point | 27.4ºC |
| Exact Mass | 327.90000 |
| LogP | 3.54990 |
| Index of Refraction | 1.359 |
| InChIKey | YOCZVAMFHOCNFS-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)I |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,2,2,3,3,4,4... CAS#:754-73-4 |
| Literature: Krespan Journal of Organic Chemistry, 1958 , vol. 23, p. 2016 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4H-Octafluor-1-jod-butan |
| 1,1,2,2,3,3,4,4-octafluoro-1-iodo-butane |
| 1-iodo-1,1,2,2,3,3,4,4-octafluorobutame |
| 1-Jod-4-H-octafluorbutan |
| 1-Iodo-1,1,2,2,3,3,4,4-octafluorobutan |
| 4H-octafluoro-1-iodo-butane |
| 1H-Octafluor-4-iodbutan |
| PC8769 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: Molecular weight of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is 327.94200. |
| Q: What is the safety information for 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: Safety information for 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane: 26-36. |
| Q: What is the molecular formula of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: Molecular formula of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is C4HF8I. |
| Q: What is the English name of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: The English name of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane. |
| Q: What is the LogP of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: LogP of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is 3.54990. |
| Q: What is the CAS number of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: CAS number of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is 754-73-4. |
| Q: What is the boiling point of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: Boiling point of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is 85ºC. |
| Q: What is the Chinese name of 754-73-4? |
| A: Chinese name of 754-73-4 is 754-73-4. |
| Q: What is the InChIKey of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane? |
| A: InChIKey of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane is YOCZVAMFHOCNFS-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane have? |
| A: English synonyms of 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane: 4H-Octafluor-1-jod-butan, 1,1,2,2,3,3,4,4-octafluoro-1-iodo-butane, 1-iodo-1,1,2,2,3,3,4,4-octafluorobutame, 1-Jod-4-H-octafluorbutan, 1-Iodo-1,1,2,2,3,3,4,4-octafluorobutan, 4H-octafluoro-1-iodo-butane, 1H-Octafluor-4-iodbutan, PC8769. |