1,1,2,2,3,3,4,4-octafluoro-1-iodobutane structure
|
Common Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane | ||
|---|---|---|---|---|
| CAS Number | 754-73-4 | Molecular Weight | 327.94200 | |
| Density | 2.082g/cm3 | Boiling Point | 85ºC | |
| Molecular Formula | C4HF8I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 27.4ºC | |
| Name | 1,1,2,2,3,3,4,4-octafluoro-1-iodobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.082g/cm3 |
|---|---|
| Boiling Point | 85ºC |
| Molecular Formula | C4HF8I |
| Molecular Weight | 327.94200 |
| Flash Point | 27.4ºC |
| Exact Mass | 327.90000 |
| LogP | 3.54990 |
| Index of Refraction | 1.359 |
| InChIKey | YOCZVAMFHOCNFS-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)I |
|
~%
1,1,2,2,3,3,4,4... CAS#:754-73-4 |
| Literature: Krespan Journal of Organic Chemistry, 1958 , vol. 23, p. 2016 |
| 4H-Octafluor-1-jod-butan |
| 1,1,2,2,3,3,4,4-octafluoro-1-iodo-butane |
| 1-iodo-1,1,2,2,3,3,4,4-octafluorobutame |
| 1-Jod-4-H-octafluorbutan |
| 1-Iodo-1,1,2,2,3,3,4,4-octafluorobutan |
| 4H-octafluoro-1-iodo-butane |
| 1H-Octafluor-4-iodbutan |
| PC8769 |