1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohex-1-ene structure
|
Common Name | 1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohex-1-ene | ||
|---|---|---|---|---|
| CAS Number | 755-25-9 | Molecular Weight | 300.04500 | |
| Density | 1.61g/cm3 | Boiling Point | 57ºC | |
| Molecular Formula | C6F12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 0ºC | |
| Name | 1,1,2,3,3,4,4,5,5,6,6,6-dodecafluorohex-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 57ºC |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04500 |
| Flash Point | 0ºC |
| Exact Mass | 299.98100 |
| LogP | 4.53220 |
| Index of Refraction | 1.268 |
| InChIKey | RMHCWMIZBMGHKV-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
1,1,2,3,3,4,4,5... CAS#:755-25-9
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 20, p. 255 - 266 |
|
~1%
Detail
|
| Literature: Zeitschrift fur Anorganische und Allgemeine Chemie, , vol. 629, # 14 p. 2499 - 2508 |
|
~%
1,1,2,3,3,4,4,5... CAS#:755-25-9 |
| Literature: Journal of Organic Chemistry USSR (English Translation), , vol. 13, p. 2329 - 2331 Zhurnal Organicheskoi Khimii, , vol. 13, # 12 p. 2504 - 2507 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| Perfluorohex-1-ene |
| perfluoro-1-hexene |
| EINECS 212-047-6 |
| dodecafluoro-hex-1-ene |
| Dodecafluor-hex-1-en |
| 1,1,2,3,3,4,4,5,5,6,6,6-dodecafluoro-1-hexene |