3,3,4,4,5,5,5-Heptafluoro-1-pentanol structure
|
Common Name | 3,3,4,4,5,5,5-Heptafluoro-1-pentanol | ||
|---|---|---|---|---|
| CAS Number | 755-40-8 | Molecular Weight | 214.081 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 84.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H5F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 4.7±25.9 °C | |
| Name | 3,3,4,4,5,5,5-heptafluoropentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 84.1±35.0 °C at 760 mmHg |
| Molecular Formula | C5H5F7O |
| Molecular Weight | 214.081 |
| Flash Point | 4.7±25.9 °C |
| Exact Mass | 214.022858 |
| PSA | 20.23000 |
| LogP | 1.29 |
| Vapour Pressure | 47.1±0.3 mmHg at 25°C |
| Index of Refraction | 1.304 |
| InChIKey | ROTSWXZIBBJEPH-UHFFFAOYSA-N |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi |
|---|
|
~%
3,3,4,4,5,5,5-H... CAS#:755-40-8 |
| Literature: Brace,N.O. Journal of Organic Chemistry, 1962 , vol. 27, p. 3033 - 3038 |
|
~%
3,3,4,4,5,5,5-H... CAS#:755-40-8 |
| Literature: Park et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1166,1168 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,3,4,4,5,5,5-Heptafluoro-1-pentanol |
| 3,3,4,4,5,5,5-Heptafluoropentan-1-ol |
| 3,3,4,4,5,5,5-heptafluoro-pentan-1-ol |
| 3,3,4,4,5,5,5-Heptafluor-pentan-1-ol |
| 1-Pentanol, 3,3,4,4,5,5,5-heptafluoro- |
| PC5434 |