3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-one structure
|
Common Name | 3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 559-96-6 | Molecular Weight | 288.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7F7O |
|---|---|
| Molecular Weight | 288.16200 |
| Exact Mass | 288.03900 |
| PSA | 17.07000 |
| LogP | 3.63110 |
| InChIKey | JAJJPAQUJSPZLI-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
3,3,4,4,5,5,5-h... CAS#:559-96-6 |
| Literature: McBee et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 917 |
|
~46%
3,3,4,4,5,5,5-h... CAS#:559-96-6
Detail
|
| Literature: Yoshida, Masato; Shimokoshi, Kazuaki; Kobayashi, Michio Chemistry Letters, 1987 , p. 433 - 436 |
|
~20%
3,3,4,4,5,5,5-h... CAS#:559-96-6
Detail
|
| Literature: Yoshida, Masato; Shimokoshi, Kazuaki; Kobayashi, Michio Chemistry Letters, 1987 , p. 433 - 436 |
| 1H,1H-heptafluoro-1-phenyl-pentan-2-one |
| 2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-phenyl |
| Benzylheptafluorpropylketon |
| 1H,1H-Heptafluor-1-phenyl-pentan-2-on |